DDT
Chemical structure of DDT |
 |
 |
| Names |
| IUPAC name
1,1,1-Trichloro-2,2-bis(4-chlorophenyl)ethane |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
| KEGG |
|
|
|
| UNII |
|
InChI=1S/C14H9Cl5/c15-11-5-1-9(2-6-11)13(14(17,18)19)10-3-7-12(16)8-4-10/h1-8,13H YKey: YVGGHNCTFXOJCH-UHFFFAOYSA-N YInChI=1/C14H9Cl5/c15-11-5-1-9(2-6-11)13(14(17,18)19)10-3-7-12(16)8-4-10/h1-8,13H Key: YVGGHNCTFXOJCH-UHFFFAOYAJ
|
Clc1ccc(cc1)C(c2ccc(Cl)cc2)C(Cl)(Cl)Cl
|
| Properties |
|
C14H9Cl5 |
| Molar mass |
354.48 g·mol−1 |
| Density |
0.99 g/cm³[1] |
| Melting point |
108.5 °C (227.3 °F; 381.6 K) |
| Boiling point |
260 °C (500 °F; 533 K) |
| Hazards |
| Occupational safety and health (OHS/OSH): |
Main hazards |
Toxic, dangerous to the environment |
| NFPA 704 (fire diamond) |
|
| Lethal dose or concentration (LD, LC): |
|
113 mg/kg (rat) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Tracking categories (test): Chemical compound |
DDT
Chemical structure of DDT |
 |
 |
| Names |
| IUPAC name
1,1,1-Trichloro-2,2-bis(4-chlorophenyl)ethane |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
| KEGG |
|
|
|
| UNII |
|
InChI=1S/C14H9Cl5/c15-11-5-1-9(2-6-11)13(14(17,18)19)10-3-7-12(16)8-4-10/h1-8,13H YKey: YVGGHNCTFXOJCH-UHFFFAOYSA-N YInChI=1/C14H9Cl5/c15-11-5-1-9(2-6-11)13(14(17,18)19)10-3-7-12(16)8-4-10/h1-8,13H Key: YVGGHNCTFXOJCH-UHFFFAOYAJ
|
Clc1ccc(cc1)C(c2ccc(Cl)cc2)C(Cl)(Cl)Cl
|
| Properties |
|
C14H9Cl5 |
| Molar mass |
354.48 g·mol−1 |
| Density |
0.99 g/cm³[1] |
| Melting point |
108.5 °C (227.3 °F; 381.6 K) |
| Boiling point |
260 °C (500 °F; 533 K) |
| Hazards |
| Occupational safety and health (OHS/OSH): |
Main hazards |
Toxic, dangerous to the environment |
| NFPA 704 (fire diamond) |
|
| Lethal dose or concentration (LD, LC): |
|
113 mg/kg (rat) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Tracking categories (test): Chemical compound |